Products 375835-04-4
CAS 375835-04-4 is the registry number for XIAP antagonist 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-5-chloro-1H-indole-2-carboxylate (CAS 375835-04-4) is a chemical compound with the molecular formula C23H25ClN4O3 and a molecular weight of 440.9 g/mol. IUPAC name: methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-5-chloro-1H-indole-2-carboxylate. InChIKey: FYKQLIUBDQREND-UHFFFAOYSA-N.
| Molecular formula | C23H25ClN4O3 |
|---|---|
| Molecular weight | 440.9 g/mol |
| IUPAC name | methyl 3-[[2-(4-benzylpiperazin-1-yl)acetyl]amino]-5-chloro-1H-indole-2-carboxylate |
| InChIKey | FYKQLIUBDQREND-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(N1)C=CC(=C2)Cl)NC(=O)CN3CCN(CC3)CC4=CC=CC=C4 |
Computed by PubChem (NCBI)