CAS 375854-71-0 is the registry number for Benzenemethanamine, 3-bromo-4-(phenylmethoxy)-, hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(3-bromo-4-phenylmethoxyphenyl)methanamine;hydrochloride (CAS 375854-71-0) is a chemical compound with the molecular formula C14H15BrClNO and a molecular weight of 328.63 g/mol. IUPAC name: (3-bromo-4-phenylmethoxyphenyl)methanamine;hydrochloride. InChIKey: QJDDFMXFQHILTG-UHFFFAOYSA-N.
| Molecular formula | C14H15BrClNO |
|---|---|
| Molecular weight | 328.63 g/mol |
| IUPAC name | (3-bromo-4-phenylmethoxyphenyl)methanamine;hydrochloride |
| InChIKey | QJDDFMXFQHILTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)CN)Br.Cl |
Computed by PubChem (NCBI)