CAS 376-27-2 appears in our catalog under these names: Methyl perfluorooctanoate, 95%, Methyl Perfluorooctanoate, >95% (GC), Perfluorooctanoic acid methyl ester, Methyl Pentadecafluorooctanoate, METHYL PERFLUOROOCTANOATE, 98%. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, GLPBio, Sigma-Aldrich. Available pack sizes: 5g, 100g, 25g, 1g, 2,5g, 100mg, 5ML.
Methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate (CAS 376-27-2) is a chemical compound with the molecular formula C9H3F15O2 and a molecular weight of 428.09 g/mol. IUPAC name: methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate. InChIKey: XOCNYZFAMHDXJK-UHFFFAOYSA-N.
| Molecular formula | C9H3F15O2 |
|---|---|
| Molecular weight | 428.09 g/mol |
| IUPAC name | methyl 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoate |
| InChIKey | XOCNYZFAMHDXJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)