CAS 376-53-4 appears in our catalog under these names: Octafluoroadiponitrile, 95%, Octafluoroadiponitrile. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg, 50mg.
2,2,3,3,4,4,5,5-octafluorohexanedinitrile (CAS 376-53-4) is a chemical compound with the molecular formula C6F8N2 and a molecular weight of 252.06 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanedinitrile. InChIKey: PZIVXXORSILYOQ-UHFFFAOYSA-N.
| Molecular formula | C6F8N2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexanedinitrile |
| InChIKey | PZIVXXORSILYOQ-UHFFFAOYSA-N |
| SMILES | C(#N)C(C(C(C(C#N)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)