Products 3761-41-9
CAS 3761-41-9 appears in our catalog under these names: Fenthion Sulfoxide, Fenthoxon Impurity 3, Fenthion Sulfoxide, >95% (HPLC), Fenthion-sulfoxide, Fenthion-sulfoxide 1000 µg/mL in Acetone. Offered by: Chemat Brand, Hubei YoungXin, TRC, Dr. Ehrenstorfer, Sigma-Aldrich. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 1ml.
Dimethoxy-(3-methyl-4-methylsulfinylphenoxy)-sulfanylidene-lambda5-phosphane (CAS 3761-41-9) is a chemical compound with the molecular formula C10H15O4PS2 and a molecular weight of 294.3 g/mol. IUPAC name: dimethoxy-(3-methyl-4-methylsulfinylphenoxy)-sulfanylidene-lambda5-phosphane. InChIKey: DLAPIMGBBDILHJ-UHFFFAOYSA-N.
| Molecular formula | C10H15O4PS2 |
|---|---|
| Molecular weight | 294.3 g/mol |
| IUPAC name | dimethoxy-(3-methyl-4-methylsulfinylphenoxy)-sulfanylidene-lambda5-phosphane |
| InChIKey | DLAPIMGBBDILHJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)S(=O)C |
Computed by PubChem (NCBI)
Synonyms:
Mesulfenfos, FENTHION SULFOXIDE, Fensulfoxide, Mesulfenos, Mesulfenfos [ISO], Mesulfenphos, Phosphorothioic acid, O,O-dimethyl O-(3-methyl-4-(methylsulfinyl)phenyl) ester, O,O-Dimethyl O-(4-(methylsulfinyl)-m-tolyl) phosphorothioate, O,O-Dimethyl O-((4-methylthio)-m-tolyl)phosphorothioate sulfoxide, Phosphorothioic acid, O,O-dimethyl O-(4-(methylsulfinyl)-m-tolyl) ester