CAS 3761-42-0 appears in our catalog under these names: Fenthion Sulfone, Fenthion Sulfone, >95% (HPLC), Fenthion-sulfone, Fenthion-sulfone 100 µg/mL in Ethyl acetate, FENTHION-SULFONE PESTANAL, 10 MG. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, Sigma-Aldrich, MedChemExpress. Available pack sizes: on request, 250mg, 25mg, 10mg, 1ml, 50 mg, 100 mg, 10 mg.
Dimethoxy-(3-methyl-4-methylsulfonylphenoxy)-sulfanylidene-lambda5-phosphane (CAS 3761-42-0) is a chemical compound with the molecular formula C10H15O5PS2 and a molecular weight of 310.3 g/mol. IUPAC name: dimethoxy-(3-methyl-4-methylsulfonylphenoxy)-sulfanylidene-lambda5-phosphane. InChIKey: ZDHYERRNXRANLI-UHFFFAOYSA-N.
| Molecular formula | C10H15O5PS2 |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | dimethoxy-(3-methyl-4-methylsulfonylphenoxy)-sulfanylidene-lambda5-phosphane |
| InChIKey | ZDHYERRNXRANLI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OP(=S)(OC)OC)S(=O)(=O)C |
Computed by PubChem (NCBI)