Products 3762-94-5

CAS 3762-94-5 appears in our catalog under these names: 1,2,5-Thiadiazole-3,4-dicarboxylic acid, 95%, 1,2,5-Thiadiazole-3,4-dicarboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

1,2,5-thiadiazole-3,4-dicarboxylic acid (CAS 3762-94-5) is a chemical compound with the molecular formula C4H2N2O4S and a molecular weight of 174.14 g/mol. IUPAC name: 1,2,5-thiadiazole-3,4-dicarboxylic acid. InChIKey: CCKODBHYAPROLJ-UHFFFAOYSA-N.

Identity
Molecular formulaC4H2N2O4S
Molecular weight174.14 g/mol
IUPAC name1,2,5-thiadiazole-3,4-dicarboxylic acid
InChIKeyCCKODBHYAPROLJ-UHFFFAOYSA-N
SMILESC1(=NSN=C1C(=O)O)C(=O)O

Computed by PubChem (NCBI)