CAS 37621-57-1 appears in our catalog under these names: 1-Bromonaphthalene-d7, 1–Bromonaphthalene–d7, 1-Bromonaphthalene-d7, 98.91%, 1-Bromonaphthalene-d7, 99 atom % D, min 98% Chemical Purity. Offered by: TRC, GLPBio, MedChemExpress, CDN. Available pack sizes: 100mg, 1g, 10g, 25g, 5g, 1 g, 10 g, 5 g.
1-bromo-2,3,4,5,6,7,8-heptadeuterionaphthalene (CAS 37621-57-1) is a chemical compound with the molecular formula C10H7Br and a molecular weight of 214.11 g/mol. IUPAC name: 1-bromo-2,3,4,5,6,7,8-heptadeuterionaphthalene. InChIKey: DLKQHBOKULLWDQ-GSNKEKJESA-N.
| Molecular formula | C10H7Br |
|---|---|
| Molecular weight | 214.11 g/mol |
| IUPAC name | 1-bromo-2,3,4,5,6,7,8-heptadeuterionaphthalene |
| InChIKey | DLKQHBOKULLWDQ-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2Br)[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)