CAS 3763-80-2 appears in our catalog under these names: Didesmethyl Chlorpromazine HCl, Didesmethylchlorpromazine Hydrochloride, >95% (HPLC), Didesmethylchlorpromazine hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 1g, 50mg, 250mg, 500mg, 1000mg.
3-(2-chlorophenothiazin-10-yl)propan-1-amine;hydrochloride (CAS 3763-80-2) is a chemical compound with the molecular formula C15H16Cl2N2S and a molecular weight of 327.3 g/mol. IUPAC name: 3-(2-chlorophenothiazin-10-yl)propan-1-amine;hydrochloride. InChIKey: CLFAUWZDUIVBAN-UHFFFAOYSA-N.
| Molecular formula | C15H16Cl2N2S |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 3-(2-chlorophenothiazin-10-yl)propan-1-amine;hydrochloride |
| InChIKey | CLFAUWZDUIVBAN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=C(S2)C=CC(=C3)Cl)CCCN.Cl |
Computed by PubChem (NCBI)