CAS 376348-78-6 appears in our catalog under these names: (S)-4,4-Difluoro-N-(3-oxo-1-phenylpropyl)cyclohexanecarboxamide, 4,4-Difluoro-N-((1S)-3-oxo-1-phenylpropyl)cyclohexanecarboxa. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 250mg, 25mg, 50mg, 500mg, 1000mg.
4,4-difluoro-N-[(1S)-3-oxo-1-phenylpropyl]cyclohexane-1-carboxamide (CAS 376348-78-6) is a chemical compound with the molecular formula C16H19F2NO2 and a molecular weight of 295.32 g/mol. IUPAC name: 4,4-difluoro-N-[(1S)-3-oxo-1-phenylpropyl]cyclohexane-1-carboxamide. InChIKey: FCEMFOOGKQYYIR-AWEZNQCLSA-N.
| Molecular formula | C16H19F2NO2 |
|---|---|
| Molecular weight | 295.32 g/mol |
| IUPAC name | 4,4-difluoro-N-[(1S)-3-oxo-1-phenylpropyl]cyclohexane-1-carboxamide |
| InChIKey | FCEMFOOGKQYYIR-AWEZNQCLSA-N |
| SMILES | C1CC(CCC1C(=O)N[C@@H](CC=O)C2=CC=CC=C2)(F)F |
Computed by PubChem (NCBI)