Products 376395-32-3

CAS 376395-32-3 is the registry number for Diethyl 1-benzyl-3,4-dihydroxy-1h-pyrrole-2,5-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate (CAS 376395-32-3) is a chemical compound with the molecular formula C17H19NO6 and a molecular weight of 333.3 g/mol. IUPAC name: diethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate. InChIKey: AXYCCUUFBQELMR-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19NO6
Molecular weight333.3 g/mol
IUPAC namediethyl 1-benzyl-3,4-dihydroxypyrrole-2,5-dicarboxylate
InChIKeyAXYCCUUFBQELMR-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=C(N1CC2=CC=CC=C2)C(=O)OCC)O)O

Computed by PubChem (NCBI)