CAS 37640-57-6 appears in our catalog under these names: Melamine cyanurate, 95%, Melamine Cyanurate, Melamine cyanurate, Melamine cyanurate, 99%, 99%. Offered by: Combi-blocks, TRC, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10mg, 100g, 500g, 25g.
1,3,5-triazinane-2,4,6-trione;1,3,5-triazine-2,4,6-triamine (CAS 37640-57-6) is a chemical compound with the molecular formula C6H9N9O3 and a molecular weight of 255.20 g/mol. IUPAC name: 1,3,5-triazinane-2,4,6-trione;1,3,5-triazine-2,4,6-triamine. InChIKey: ZQKXQUJXLSSJCH-UHFFFAOYSA-N.
| Molecular formula | C6H9N9O3 |
|---|---|
| Molecular weight | 255.20 g/mol |
| IUPAC name | 1,3,5-triazinane-2,4,6-trione;1,3,5-triazine-2,4,6-triamine |
| InChIKey | ZQKXQUJXLSSJCH-UHFFFAOYSA-N |
| SMILES | C1(=NC(=NC(=N1)N)N)N.C1(=O)NC(=O)NC(=O)N1 |
Computed by PubChem (NCBI)