Products 376588-53-3
CAS 376588-53-3 is the registry number for DRF-4848. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2-fluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)-2H-furan-5-one (CAS 376588-53-3) is a chemical compound with the molecular formula C17H12F2O4S and a molecular weight of 350.3 g/mol. IUPAC name: 3-(2-fluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)-2H-furan-5-one. InChIKey: QDQJUYABKLGZAK-UHFFFAOYSA-N.
| Molecular formula | C17H12F2O4S |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 3-(2-fluoro-4-methylsulfonylphenyl)-4-(4-fluorophenyl)-2H-furan-5-one |
| InChIKey | QDQJUYABKLGZAK-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC(=C(C=C1)C2=C(C(=O)OC2)C3=CC=C(C=C3)F)F |
Computed by PubChem (NCBI)