CAS 376591-94-5 appears in our catalog under these names: Eltrombopag Impurity 20, 2'-Methoxy-3'-nitro-(1,1'-biphenyl)-3-carboxylic Acid, 2'–Methoxy–3'–nitro–biphenyl–3–carboxylic acid, 2'-Methoxy-3'-nitro-[1,1'-biphenyl]-3-carboxylic acid 98+%, 2'-Methoxy-3'-nitro-[1,1'-biphenyl]-3-carboxylicacid, 98+%, 98+%. Offered by: Chemat Brand, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: on request, 1g, 25g, 5g, 100g.
3-(2-methoxy-3-nitrophenyl)benzoic acid (CAS 376591-94-5) is a chemical compound with the molecular formula C14H11NO5 and a molecular weight of 273.24 g/mol. IUPAC name: 3-(2-methoxy-3-nitrophenyl)benzoic acid. InChIKey: AAPGMCIBKOSNAL-UHFFFAOYSA-N.
| Molecular formula | C14H11NO5 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 3-(2-methoxy-3-nitrophenyl)benzoic acid |
| InChIKey | AAPGMCIBKOSNAL-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC=C1[N+](=O)[O-])C2=CC(=CC=C2)C(=O)O |
Computed by PubChem (NCBI)