CAS 376608-70-7 is the registry number for Ticagrelor Impurity 90. Offered by: Chemat Brand. Available pack sizes: on request.
Trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carbonyl chloride (CAS 376608-70-7) is a chemical compound with the molecular formula C10H7ClF2O and a molecular weight of 216.61 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carbonyl chloride. InChIKey: VSBZGERVJAWYAP-NKWVEPMBSA-N.
| Molecular formula | C10H7ClF2O |
|---|---|
| Molecular weight | 216.61 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carbonyl chloride |
| InChIKey | VSBZGERVJAWYAP-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)Cl)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)