CAS 37687-67-5 is the registry number for 4-(Benzyloxy)-3-chloro-5-methoxybenzaldehyde. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
3-chloro-5-methoxy-4-phenylmethoxybenzaldehyde (CAS 37687-67-5) is a chemical compound with the molecular formula C15H13ClO3 and a molecular weight of 276.71 g/mol. IUPAC name: 3-chloro-5-methoxy-4-phenylmethoxybenzaldehyde. InChIKey: WEMFQFIVISYIOP-UHFFFAOYSA-N.
| Molecular formula | C15H13ClO3 |
|---|---|
| Molecular weight | 276.71 g/mol |
| IUPAC name | 3-chloro-5-methoxy-4-phenylmethoxybenzaldehyde |
| InChIKey | WEMFQFIVISYIOP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1)C=O)Cl)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)