CAS 37699-47-1 appears in our catalog under these names: 2-(3,4-Dimethoxyphenyl)ethyl-1,1-d2-amine, 98 atom % D, min 98% Chemical Purity, 2–(3,4–DIMETHOXYPHENYL)ETHYL–1,1–D2–AMINE, 2-(3,4-Dimethoxyphenyl)ethyl-1,1-d2-amine. Offered by: CDN, GLPBio, Biosynth. Available pack sizes: 0,25g, 0,1g, 10mg, 100mg, 50mg.
1,1-dideuterio-2-(3,4-dimethoxyphenyl)ethanamine (CAS 37699-47-1) is a chemical compound with the molecular formula C10H15NO2 and a molecular weight of 183.24 g/mol. IUPAC name: 1,1-dideuterio-2-(3,4-dimethoxyphenyl)ethanamine. InChIKey: ANOUKFYBOAKOIR-NCYHJHSESA-N.
| Molecular formula | C10H15NO2 |
|---|---|
| Molecular weight | 183.24 g/mol |
| IUPAC name | 1,1-dideuterio-2-(3,4-dimethoxyphenyl)ethanamine |
| InChIKey | ANOUKFYBOAKOIR-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(CC1=CC(=C(C=C1)OC)OC)N |
Computed by PubChem (NCBI)