CAS 377-33-3 is the registry number for Tetrafluorosuccinimide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3,3,4,4-tetrafluoropyrrolidine-2,5-dione (CAS 377-33-3) is a chemical compound with the molecular formula C4HF4NO2 and a molecular weight of 171.05 g/mol. IUPAC name: 3,3,4,4-tetrafluoropyrrolidine-2,5-dione. InChIKey: LHNPDXSWOZFOAO-UHFFFAOYSA-N.
| Molecular formula | C4HF4NO2 |
|---|---|
| Molecular weight | 171.05 g/mol |
| IUPAC name | 3,3,4,4-tetrafluoropyrrolidine-2,5-dione |
| InChIKey | LHNPDXSWOZFOAO-UHFFFAOYSA-N |
| SMILES | C1(=O)C(C(C(=O)N1)(F)F)(F)F |
Computed by PubChem (NCBI)