CAS 377-36-6 appears in our catalog under these names: 1H,4H-Octafluorobutane, 95%, 1H,4H–Octafluorobutane. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 25g.
1,1,2,2,3,3,4,4-octafluorobutane (CAS 377-36-6) is a chemical compound with the molecular formula C4H2F8 and a molecular weight of 202.05 g/mol. IUPAC name: 1,1,2,2,3,3,4,4-octafluorobutane. InChIKey: LKLFXAVIFCLZQS-UHFFFAOYSA-N.
| Molecular formula | C4H2F8 |
|---|---|
| Molecular weight | 202.05 g/mol |
| IUPAC name | 1,1,2,2,3,3,4,4-octafluorobutane |
| InChIKey | LKLFXAVIFCLZQS-UHFFFAOYSA-N |
| SMILES | C(C(C(C(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)