CAS 377-38-8 appears in our catalog under these names: Tetrafluorosuccinic acid, 95%, Tetrafluorosuccinic acid, Tetrafluorosuccinic acid, 97% , Tetrafluorosuccinic Acid, >98.0%(T), 2,2,3,3-Tetrafluorosuccinic acid 98%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 5g, 25g, 1g, 100g, 10g, 2,5g, 500mg, 50g.
2,2,3,3-tetrafluorobutanedioic acid (CAS 377-38-8) is a chemical compound with the molecular formula C4H2F4O4 and a molecular weight of 190.05 g/mol. IUPAC name: 2,2,3,3-tetrafluorobutanedioic acid. InChIKey: YUDUFRYTKFGQCL-UHFFFAOYSA-N.
| Molecular formula | C4H2F4O4 |
|---|---|
| Molecular weight | 190.05 g/mol |
| IUPAC name | 2,2,3,3-tetrafluorobutanedioic acid |
| InChIKey | YUDUFRYTKFGQCL-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(=O)O)(F)F)(F)F)O |
Computed by PubChem (NCBI)