CAS 377-93-5 is the registry number for 1,2-Dichlorotetrafluorocyclobutene-1, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
1,2-dichloro-3,3,4,4-tetrafluorocyclobutene (CAS 377-93-5) is a chemical compound with the molecular formula C4Cl2F4 and a molecular weight of 194.94 g/mol. IUPAC name: 1,2-dichloro-3,3,4,4-tetrafluorocyclobutene. InChIKey: KAHIKRWJVIBASP-UHFFFAOYSA-N.
| Molecular formula | C4Cl2F4 |
|---|---|
| Molecular weight | 194.94 g/mol |
| IUPAC name | 1,2-dichloro-3,3,4,4-tetrafluorocyclobutene |
| InChIKey | KAHIKRWJVIBASP-UHFFFAOYSA-N |
| SMILES | C1(=C(C(C1(F)F)(F)F)Cl)Cl |
Computed by PubChem (NCBI)