CAS 37717-99-0 is the registry number for Sodium 5-bromo-2-hydroxybenzoate, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium 5-bromo-2-hydroxybenzoate (CAS 37717-99-0) is a chemical compound with the molecular formula C7H4BrNaO3 and a molecular weight of 239.00 g/mol. IUPAC name: sodium 5-bromo-2-hydroxybenzoate. InChIKey: XDWBXMATAPGYAK-UHFFFAOYSA-M.
| Molecular formula | C7H4BrNaO3 |
|---|---|
| Molecular weight | 239.00 g/mol |
| IUPAC name | sodium 5-bromo-2-hydroxybenzoate |
| InChIKey | XDWBXMATAPGYAK-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Br)C(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)