CAS 3772-44-9 appears in our catalog under these names: Carboxyarsenazo, Carboxyarsenazo III, Carboxyarsenazo III, min. 95 %, 5 mg, Carboxyarsenazo III, min. 95 %, 10 mg, Carboxyarsenazo III, min. 95 %, 25 mg. Offered by: TRC, Biosynth, Roth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
2-[[7-[(2-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid (CAS 3772-44-9) is a chemical compound with the molecular formula C23H17AsN4O13S2 and a molecular weight of 696.5 g/mol. IUPAC name: 2-[[7-[(2-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid. InChIKey: RZYBKUZTYOBWAB-UHFFFAOYSA-N.
| Molecular formula | C23H17AsN4O13S2 |
|---|---|
| Molecular weight | 696.5 g/mol |
| IUPAC name | 2-[[7-[(2-arsonophenyl)diazenyl]-1,8-dihydroxy-3,6-disulfonaphthalen-2-yl]diazenyl]benzoic acid |
| InChIKey | RZYBKUZTYOBWAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)N=NC2=C(C=C3C=C(C(=C(C3=C2O)O)N=NC4=CC=CC=C4[As](=O)(O)O)S(=O)(=O)O)S(=O)(=O)O |
Computed by PubChem (NCBI)