Products 3772-56-3
CAS 3772-56-3 is the registry number for Totaradiol. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
(2S,4aS,10aR)-1,1,4a-trimethyl-8-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol (CAS 3772-56-3) is a chemical compound with the molecular formula C20H30O2 and a molecular weight of 302.5 g/mol. IUPAC name: (2S,4aS,10aR)-1,1,4a-trimethyl-8-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol. InChIKey: NORGIWDZGWMMGU-ABSDTBQOSA-N.
| Molecular formula | C20H30O2 |
|---|---|
| Molecular weight | 302.5 g/mol |
| IUPAC name | (2S,4aS,10aR)-1,1,4a-trimethyl-8-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-2,7-diol |
| InChIKey | NORGIWDZGWMMGU-ABSDTBQOSA-N |
| SMILES | CC(C)C1=C(C=CC2=C1CC[C@@H]3[C@@]2(CC[C@@H](C3(C)C)O)C)O |
Computed by PubChem (NCBI)