CAS 37743-18-3 appears in our catalog under these names: 3,3-Diphenyltetrahydrofuran-2-ylidene(dimethyl)ammonium bromide, 95%, Loperamide Impurity, (3,3-Diphenyldihydrofuran-2-ylidine)dimethylammonium bromide, 98+%, Dimethyl-(tetrahydro-3,3-diphenyl-2-furilidine)ammonium Bromide, Dimethyl(tetrahydro-3,3-diphenyl-2-furylidene)ammonium Bromide. Offered by: Combi-blocks, Chemat Brand, AmBeed, Mikromol, TRC. Available pack sizes: 25g, 100mg, 1g, 5g, on request, 25mg, 2g, 10g.
(3,3-diphenyloxolan-2-ylidene)-dimethylazanium bromide (CAS 37743-18-3) is a chemical compound with the molecular formula C18H20BrNO and a molecular weight of 346.3 g/mol. IUPAC name: (3,3-diphenyloxolan-2-ylidene)-dimethylazanium bromide. InChIKey: QJPXLCQSAFQCBD-UHFFFAOYSA-M.
| Molecular formula | C18H20BrNO |
|---|---|
| Molecular weight | 346.3 g/mol |
| IUPAC name | (3,3-diphenyloxolan-2-ylidene)-dimethylazanium bromide |
| InChIKey | QJPXLCQSAFQCBD-UHFFFAOYSA-M |
| SMILES | C[N+](=C1C(CCO1)(C2=CC=CC=C2)C3=CC=CC=C3)C.[Br-] |
Computed by PubChem (NCBI)