CAS 37763-28-3 appears in our catalog under these names: Potassium p-Aminophenyl Sulphate, 98%, Potassium p-Aminophenyl Sulphate, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg.
Potassium (4-aminophenyl) sulfate (CAS 37763-28-3) is a chemical compound with the molecular formula C6H6KNO4S and a molecular weight of 227.28 g/mol. IUPAC name: potassium (4-aminophenyl) sulfate. InChIKey: LIYRGUNGMFJTRE-UHFFFAOYSA-M.
| Molecular formula | C6H6KNO4S |
|---|---|
| Molecular weight | 227.28 g/mol |
| IUPAC name | potassium (4-aminophenyl) sulfate |
| InChIKey | LIYRGUNGMFJTRE-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1N)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)