CAS 377769-45-4 is the registry number for 3-(4-Chlorophenyl)-2-(4-fluorophenyl)prop-2-enoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
(E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoic acid (CAS 377769-45-4) is a chemical compound with the molecular formula C15H10ClFO2 and a molecular weight of 276.69 g/mol. IUPAC name: (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoic acid. InChIKey: CDSOETPFPCFBHL-NTEUORMPSA-N.
| Molecular formula | C15H10ClFO2 |
|---|---|
| Molecular weight | 276.69 g/mol |
| IUPAC name | (E)-3-(4-chlorophenyl)-2-(4-fluorophenyl)prop-2-enoic acid |
| InChIKey | CDSOETPFPCFBHL-NTEUORMPSA-N |
| SMILES | C1=CC(=CC=C1/C=C(\C2=CC=C(C=C2)F)/C(=O)O)Cl |
Computed by PubChem (NCBI)