Products 37784-16-0
CAS 37784-16-0 is the registry number for D-Prolyl-L-proline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid (CAS 37784-16-0) is a chemical compound with the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. IUPAC name: (2S)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid. InChIKey: RWCOTTLHDJWHRS-SFYZADRCSA-N.
| Molecular formula | C10H16N2O3 |
|---|---|
| Molecular weight | 212.25 g/mol |
| IUPAC name | (2S)-1-[(2R)-pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | RWCOTTLHDJWHRS-SFYZADRCSA-N |
| SMILES | C1C[C@@H](NC1)C(=O)N2CCC[C@H]2C(=O)O |
Computed by PubChem (NCBI)