CAS 37785-57-2 appears in our catalog under these names: 2,4,5-Trichlorophenoxyacetic acid potassium salt, 98%, Potassium 2,4,5–trichlorophenoxyacetate, Potassium 2,4,5-trichlorophenoxyacetate, 98%, 98%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 100g, 5g, 25g, 1g.
Potassium 2-(2,4,5-trichlorophenoxy)acetate (CAS 37785-57-2) is a chemical compound with the molecular formula C8H4Cl3KO3 and a molecular weight of 293.6 g/mol. IUPAC name: potassium 2-(2,4,5-trichlorophenoxy)acetate. InChIKey: LUDUIQAQFKIYND-UHFFFAOYSA-M.
| Molecular formula | C8H4Cl3KO3 |
|---|---|
| Molecular weight | 293.6 g/mol |
| IUPAC name | potassium 2-(2,4,5-trichlorophenoxy)acetate |
| InChIKey | LUDUIQAQFKIYND-UHFFFAOYSA-M |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)OCC(=O)[O-].[K+] |
Computed by PubChem (NCBI)