CAS 3779-63-3 appears in our catalog under these names: (2,4,6-Trioxotriazine-1,3,5(2H,4H,6H)-triyl)tris(hexamethylene) isocyanate, Hexamethylene Diisocyanate Isocyanurate Trimer, 1,3,5-Tris(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione, >95.0%(T), Tris(6-isocyanatohexyl)isocyanurate 95% (T), Hexamethylene Diisocyanate Isocyanurate Trimer, 95% (T), 95% (T). Offered by: Roth, TRC, TCI, Biosynth, Ambeed. Available pack sizes: 250g, 500mg, 5g, 25g, 0,5kg, 0,25kg, 1kg, 2kg.
1,3,5-tris(6-isocyanatohexyl)-1,3,5-triazin-2,4,6-trione is a triisocyanate being a derivative of isocyanuric acid with a 6-isocyanatohexyl group at each of the 1-, 3- and 5-positions. It is functionally related to an isocyanuric acid.
Source: ChEBI
| Molecular formula | C24H36N6O6 |
|---|---|
| Molecular weight | 504.6 g/mol |
| IUPAC name | 1,3,5-tris(6-isocyanatohexyl)-1,3,5-triazinane-2,4,6-trione |
| InChIKey | KCZQSKKNAGZQSZ-UHFFFAOYSA-N |
| SMILES | C(CCCN1C(=O)N(C(=O)N(C1=O)CCCCCCN=C=O)CCCCCCN=C=O)CCN=C=O |
Computed by PubChem (NCBI)