CAS 37796-78-4 is the registry number for 2-Bromo-6-methylnaphthalene. Offered by: TRC. Available pack sizes: 500mg, 5g.
2-bromo-6-methylnaphthalene (CAS 37796-78-4) is a chemical compound with the molecular formula C11H9Br and a molecular weight of 221.09 g/mol. IUPAC name: 2-bromo-6-methylnaphthalene. InChIKey: LIGQAYZZFOJVBD-UHFFFAOYSA-N.
| Molecular formula | C11H9Br |
|---|---|
| Molecular weight | 221.09 g/mol |
| IUPAC name | 2-bromo-6-methylnaphthalene |
| InChIKey | LIGQAYZZFOJVBD-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)