CAS 378-76-7 appears in our catalog under these names: Potassium pentafluoropropionate, 95%, Potassium pentafluoropropionate, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 25g, 5g, 1g.
Potassium 2,2,3,3,3-pentafluoropropanoate (CAS 378-76-7) is a chemical compound with the molecular formula C3F5KO2 and a molecular weight of 202.12 g/mol. IUPAC name: potassium 2,2,3,3,3-pentafluoropropanoate. InChIKey: AHGFDQXBCIASJK-UHFFFAOYSA-M.
| Molecular formula | C3F5KO2 |
|---|---|
| Molecular weight | 202.12 g/mol |
| IUPAC name | potassium 2,2,3,3,3-pentafluoropropanoate |
| InChIKey | AHGFDQXBCIASJK-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(F)(F)F)(F)F)[O-].[K+] |
Computed by PubChem (NCBI)