CAS 37828-01-6 is the registry number for 3,5-Bis(chlorosulfonyl)benzoyl Chloride. Offered by: TRC. Available pack sizes: 1g.
3,5-bis(chlorosulfonyl)benzoyl chloride (CAS 37828-01-6) is a chemical compound with the molecular formula C7H3Cl3O5S2 and a molecular weight of 337.6 g/mol. IUPAC name: 3,5-bis(chlorosulfonyl)benzoyl chloride. InChIKey: UCPAOLHXMFSGKT-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O5S2 |
|---|---|
| Molecular weight | 337.6 g/mol |
| IUPAC name | 3,5-bis(chlorosulfonyl)benzoyl chloride |
| InChIKey | UCPAOLHXMFSGKT-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1S(=O)(=O)Cl)S(=O)(=O)Cl)C(=O)Cl |
Computed by PubChem (NCBI)