CAS 3784-03-0 appears in our catalog under these names: Sodium 2,4,6-trichlorophenolate, 95%, Sodium 2,4,6–trichlorophenolate, 2,4,6-Trichlorophenol Sodium Salt, >95.0%(T), Sodium 2,4,6-trichlorophenolate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Chemat. Available pack sizes: 1g, 25g, 5g, 10g.
Sodium 2,4,6-trichlorophenolate (CAS 3784-03-0) is a chemical compound with the molecular formula C6H2Cl3NaO and a molecular weight of 219.4 g/mol. IUPAC name: sodium 2,4,6-trichlorophenolate. InChIKey: MWWVVWIHGYXNNR-UHFFFAOYSA-M.
| Molecular formula | C6H2Cl3NaO |
|---|---|
| Molecular weight | 219.4 g/mol |
| IUPAC name | sodium 2,4,6-trichlorophenolate |
| InChIKey | MWWVVWIHGYXNNR-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C(=C1Cl)[O-])Cl)Cl.[Na+] |
Computed by PubChem (NCBI)