CAS 37858-04-1 appears in our catalog under these names: 1H,1H,2H,2H-Perfluorodecyl Acetate, >95% (GC), 1H,1H,2H,2H-Perfluorodecyl acetate. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 100mg, 250mg, 25mg.
3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl acetate (CAS 37858-04-1) is a chemical compound with the molecular formula C12H7F17O2 and a molecular weight of 506.15 g/mol. IUPAC name: 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl acetate. InChIKey: CPOHLPPQNCULDC-UHFFFAOYSA-N.
| Molecular formula | C12H7F17O2 |
|---|---|
| Molecular weight | 506.15 g/mol |
| IUPAC name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl acetate |
| InChIKey | CPOHLPPQNCULDC-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)