Products 3786-39-8

CAS 3786-39-8 appears in our catalog under these names: 1,3-Dioxo-1,3-dihydroisobenzofuran-4-carboxylic acid 97%, 1,3-Dioxo-1,3-dihydroisobenzofuran-4-carboxylic acid, 97%, 97%, 1,3-Dioxo-1,3-dihydroisobenzofuran-4-carboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,3-dioxo-2-benzofuran-4-carboxylic acid (CAS 3786-39-8) is a chemical compound with the molecular formula C9H4O5 and a molecular weight of 192.12 g/mol. IUPAC name: 1,3-dioxo-2-benzofuran-4-carboxylic acid. InChIKey: ZCEHQPCGOUBSJR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H4O5
Molecular weight192.12 g/mol
IUPAC name1,3-dioxo-2-benzofuran-4-carboxylic acid
InChIKeyZCEHQPCGOUBSJR-UHFFFAOYSA-N
SMILESC1=CC2=C(C(=C1)C(=O)O)C(=O)OC2=O

Computed by PubChem (NCBI)