CAS 37860-51-8 appears in our catalog under these names: Bis-Tos-PEG4/ 99.06% (existing batch purity), Bis–Tos–PEG4, Tetraethylene Glycol Bis(p-toluenesulfonate), >98.0%(T), Bis-Tos-PEG4 97%, TETRA(ETHYLENE GLYCOL) DI-P-TOSYLATE, 9&. Offered by: TargetMol, GLPBio, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 1g, 500mg, 25g, 1000g, 5g, 10g, 100g, 500g.
2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 37860-51-8) is a chemical compound with the molecular formula C22H30O9S2 and a molecular weight of 502.6 g/mol. IUPAC name: 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: SLAONPBUWDUSSO-UHFFFAOYSA-N.
| Molecular formula | C22H30O9S2 |
|---|---|
| Molecular weight | 502.6 g/mol |
| IUPAC name | 2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | SLAONPBUWDUSSO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)