CAS 378787-34-9 is the registry number for 1-Bromo-2-[tris(1-methylethyl)silyloxy]benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2-bromophenoxy)-tri(propan-2-yl)silane (CAS 378787-34-9) is a chemical compound with the molecular formula C15H25BrOSi and a molecular weight of 329.35 g/mol. IUPAC name: (2-bromophenoxy)-tri(propan-2-yl)silane. InChIKey: DRKVJKKIFDUDIL-UHFFFAOYSA-N.
| Molecular formula | C15H25BrOSi |
|---|---|
| Molecular weight | 329.35 g/mol |
| IUPAC name | (2-bromophenoxy)-tri(propan-2-yl)silane |
| InChIKey | DRKVJKKIFDUDIL-UHFFFAOYSA-N |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)OC1=CC=CC=C1Br |
Computed by PubChem (NCBI)