Products 37880-96-9

CAS 37880-96-9 is the registry number for 2-Mercapto-N,N,N-trimethylethanaminium chloride, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Trimethyl(2-sulfanylethyl)azanium chloride (CAS 37880-96-9) is a chemical compound with the molecular formula C5H14ClNS and a molecular weight of 155.69 g/mol. IUPAC name: trimethyl(2-sulfanylethyl)azanium chloride. InChIKey: JKUAUCQIEHEDSL-UHFFFAOYSA-N.

Identity
Molecular formulaC5H14ClNS
Molecular weight155.69 g/mol
IUPAC nametrimethyl(2-sulfanylethyl)azanium chloride
InChIKeyJKUAUCQIEHEDSL-UHFFFAOYSA-N
SMILESC[N+](C)(C)CCS.[Cl-]

Computed by PubChem (NCBI)