CAS 37881-62-2 is the registry number for Octafluoroadipoyl difluoride. Offered by: Biosynth. Available pack sizes: 0,01kg, 0,025kg.
2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride (CAS 37881-62-2) is a chemical compound with the molecular formula C6F10O2 and a molecular weight of 294.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride. InChIKey: FDGCJTUAVVJFMB-UHFFFAOYSA-N.
| Molecular formula | C6F10O2 |
|---|---|
| Molecular weight | 294.05 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride |
| InChIKey | FDGCJTUAVVJFMB-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(C(=O)F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)