Products 37881-62-2

CAS 37881-62-2 is the registry number for Octafluoroadipoyl difluoride. Offered by: Biosynth. Available pack sizes: 0,01kg, 0,025kg.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride (CAS 37881-62-2) is a chemical compound with the molecular formula C6F10O2 and a molecular weight of 294.05 g/mol. IUPAC name: 2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride. InChIKey: FDGCJTUAVVJFMB-UHFFFAOYSA-N.

Identity
Molecular formulaC6F10O2
Molecular weight294.05 g/mol
IUPAC name2,2,3,3,4,4,5,5-octafluorohexanedioyl difluoride
InChIKeyFDGCJTUAVVJFMB-UHFFFAOYSA-N
SMILESC(=O)(C(C(C(C(C(=O)F)(F)F)(F)F)(F)F)(F)F)F

Computed by PubChem (NCBI)