CAS 37888-15-6 appears in our catalog under these names: 2-{((2,2,2-trifluoroethoxy)carbonyl)amino}acetic acid, 95%, 2-{((2,2,2-Trifluoroethoxy)carbonyl)amino}acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-(2,2,2-trifluoroethoxycarbonylamino)acetic acid (CAS 37888-15-6) is a chemical compound with the molecular formula C5H6F3NO4 and a molecular weight of 201.10 g/mol. IUPAC name: 2-(2,2,2-trifluoroethoxycarbonylamino)acetic acid. InChIKey: NHKPMEUDEOXKQX-UHFFFAOYSA-N.
| Molecular formula | C5H6F3NO4 |
|---|---|
| Molecular weight | 201.10 g/mol |
| IUPAC name | 2-(2,2,2-trifluoroethoxycarbonylamino)acetic acid |
| InChIKey | NHKPMEUDEOXKQX-UHFFFAOYSA-N |
| SMILES | C(C(=O)O)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)