CAS 3792-02-7 appears in our catalog under these names: 5,5,6,6,7,7,8,8,8-Nonafluorooctan-1-ol, 98%, 5,5,6,6,7,7,8,8,8-Nonafluorooctan-1-ol, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 5g.
5,5,6,6,7,7,8,8,8-nonafluorooctan-1-ol (CAS 3792-02-7) is a chemical compound with the molecular formula C8H9F9O and a molecular weight of 292.14 g/mol. IUPAC name: 5,5,6,6,7,7,8,8,8-nonafluorooctan-1-ol. InChIKey: FROXCSGRCWYTIE-UHFFFAOYSA-N.
| Molecular formula | C8H9F9O |
|---|---|
| Molecular weight | 292.14 g/mol |
| IUPAC name | 5,5,6,6,7,7,8,8,8-nonafluorooctan-1-ol |
| InChIKey | FROXCSGRCWYTIE-UHFFFAOYSA-N |
| SMILES | C(CCO)CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)