CAS 3792-50-5 appears in our catalog under these names: L–Aspartic aicd sodium, L-Aspartic aicd sodium/ 99.92% (existing batch purity), H-Asp-OH (sodium) 98%, (S)-2-Aminosuccinic acid, sodium salt, 98%, 98%, L-Aspartic aicd (sodium), 98.0%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 500mg, 100g, 500g, 1000g, 200g, 1kg, 5kg, 500 mg.
Sodium (2S)-2-amino-4-hydroxy-4-oxobutanoate (CAS 3792-50-5) is a chemical compound with the molecular formula C4H6NNaO4 and a molecular weight of 155.08 g/mol. IUPAC name: sodium (2S)-2-amino-4-hydroxy-4-oxobutanoate. InChIKey: WTWSHHITWMVLBX-DKWTVANSSA-M.
| Molecular formula | C4H6NNaO4 |
|---|---|
| Molecular weight | 155.08 g/mol |
| IUPAC name | sodium (2S)-2-amino-4-hydroxy-4-oxobutanoate |
| InChIKey | WTWSHHITWMVLBX-DKWTVANSSA-M |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)O.[Na+] |
Computed by PubChem (NCBI)