CAS 379228-45-2 appears in our catalog under these names: 5-Chloro-1,3-benzodioxol-4-amine, 98%, 5–CHLORO–1,3–BENZODIOXOL–4–AMINE, 5-Chlorobenzo[d][1,3]dioxol-4-amine 98%, 5-CHLORO-1,3-BENZODIOXOL-4-AMINE, 98%, 98%, 5-Chlorobenzo[d][1,3]dioxol-4-amine, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-chloro-1,3-benzodioxol-4-amine (CAS 379228-45-2) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 5-chloro-1,3-benzodioxol-4-amine. InChIKey: YUTNKFUXNHFBGS-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 5-chloro-1,3-benzodioxol-4-amine |
| InChIKey | YUTNKFUXNHFBGS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=C(C=C2)Cl)N |
Computed by PubChem (NCBI)