CAS 379253-60-8 appears in our catalog under these names: 4-(2,6-Dibromo-4-methyl-phenoxymethyl)-benzoic acid hydrazide, 95%, 4-(2,6-Dibromo-4-methylphenoxymethyl)benzohydrazide, 95%, 4-(2,6-Dibromo-4-methylphenoxymethyl)benzohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(2,6-dibromo-4-methylphenoxy)methyl]benzohydrazide (CAS 379253-60-8) is a chemical compound with the molecular formula C15H14Br2N2O2 and a molecular weight of 414.09 g/mol. IUPAC name: 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzohydrazide. InChIKey: SPHAWFCEDPCJJD-UHFFFAOYSA-N.
| Molecular formula | C15H14Br2N2O2 |
|---|---|
| Molecular weight | 414.09 g/mol |
| IUPAC name | 4-[(2,6-dibromo-4-methylphenoxy)methyl]benzohydrazide |
| InChIKey | SPHAWFCEDPCJJD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)Br)OCC2=CC=C(C=C2)C(=O)NN)Br |
Computed by PubChem (NCBI)