CAS 379254-58-7 is the registry number for 2-Chloro-5-[(4-fluoro-phenyl)-methyl-sulfamoyl]-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g.
2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid (CAS 379254-58-7) is a chemical compound with the molecular formula C14H11ClFNO4S and a molecular weight of 343.8 g/mol. IUPAC name: 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid. InChIKey: OQZORFCSUZSIDR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClFNO4S |
|---|---|
| Molecular weight | 343.8 g/mol |
| IUPAC name | 2-chloro-5-[(4-fluorophenyl)-methylsulfamoyl]benzoic acid |
| InChIKey | OQZORFCSUZSIDR-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)F)S(=O)(=O)C2=CC(=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)