CAS 379257-04-2 is the registry number for 3-(2,3-Dihydro-1,4-benzodioxine-6-sulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid (CAS 379257-04-2) is a chemical compound with the molecular formula C15H13NO6S and a molecular weight of 335.3 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid. InChIKey: ZOJIHMPEOUAVKG-UHFFFAOYSA-N.
| Molecular formula | C15H13NO6S |
|---|---|
| Molecular weight | 335.3 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)benzoic acid |
| InChIKey | ZOJIHMPEOUAVKG-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)S(=O)(=O)NC3=CC=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)