CAS 37933-88-3 appears in our catalog under these names: Ac-val-nh2, 98%, AC–Val–NH2, Ac–Val–NH₂, Ac-L-Val-NH2, N-Acetyl-L-valinamide, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100g, 25g, 250mg, 10g.
(2S)-2-acetamido-3-methylbutanamide (CAS 37933-88-3) is a chemical compound with the molecular formula C7H14N2O2 and a molecular weight of 158.20 g/mol. IUPAC name: (2S)-2-acetamido-3-methylbutanamide. InChIKey: WEHJKQHCMGQEEF-LURJTMIESA-N.
| Molecular formula | C7H14N2O2 |
|---|---|
| Molecular weight | 158.20 g/mol |
| IUPAC name | (2S)-2-acetamido-3-methylbutanamide |
| InChIKey | WEHJKQHCMGQEEF-LURJTMIESA-N |
| SMILES | CC(C)[C@@H](C(=O)N)NC(=O)C |
Computed by PubChem (NCBI)