Products 37934-89-7
CAS 37934-89-7 appears in our catalog under these names: 2,6-Dimethyl-4-methoxybenzoic acid, 95%, 2，6–Dimethyl–4–methoxybenzoic acid, 2,6-Dimethyl-4-methoxybenzoic acid, 2,6-Dimethyl-4-methoxybenzoic acid 98%, Benzoic acid, 4-methoxy-2,6-dimethyl-, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5g, 1g, 10g, 250mg, 25g, 50g, 100g, 100mg.
4-methoxy-2,6-dimethylbenzoic acid (CAS 37934-89-7) is a chemical compound with the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. IUPAC name: 4-methoxy-2,6-dimethylbenzoic acid. InChIKey: GFWRERVOFRPXKB-UHFFFAOYSA-N.
| Molecular formula | C10H12O3 |
|---|---|
| Molecular weight | 180.20 g/mol |
| IUPAC name | 4-methoxy-2,6-dimethylbenzoic acid |
| InChIKey | GFWRERVOFRPXKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C(=O)O)C)OC |
Computed by PubChem (NCBI)