CAS 3794-64-7 is the registry number for Silver heptafluorobutyrate, 95%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 5g, 25g, on request.
Silver 2,2,3,3,4,4,4-heptafluorobutanoate (CAS 3794-64-7) is a chemical compound with the molecular formula C4AgF7O2 and a molecular weight of 320.90 g/mol. IUPAC name: silver 2,2,3,3,4,4,4-heptafluorobutanoate. InChIKey: GPNIJXACCBKBEP-UHFFFAOYSA-M.
| Molecular formula | C4AgF7O2 |
|---|---|
| Molecular weight | 320.90 g/mol |
| IUPAC name | silver 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChIKey | GPNIJXACCBKBEP-UHFFFAOYSA-M |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)[O-].[Ag+] |
Computed by PubChem (NCBI)